Showing entry for Euparin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037880 |
| Compound Name | Euparin |
| Structure | ![]() |
| Formula | C13H12O3 |
| InchiKey | OPUFDNZTKHPZHM-UHFFFAOYSA-N |
| SMILES | CC(=C)c1cc2c(o1)cc(c(c2)C(=O)C)O |
| Inchi | InChI=1S/C13H12O3/c1-7(2)12-5-9-4-10(8(3)14)11(15)6-13(9)16-12/h4-6,15H,1H2,2-3H3 |
| IUPAC | 1-(6-hydroxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone |
| Molecular Weight | 216.08 |
| Pubchem Id | 119039 |
| Chembl Id | CHEMBL503938 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL503938 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
