Showing entry for Aconitate Ion
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0037905 |
| Compound Name | Aconitate Ion |
| Structure | ![]() |
| Formula | C6H6O6 |
| InchiKey | GTZCVFVGUGFEME-HNQUOIGGSA-K |
| SMILES | [O-]C(=O)C/C(=C\C(=O)[O-])/C(=O)[O-] |
| Inchi | InChI=1S/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1+ |
| IUPAC | (E)-prop-1-ene-1,2,3-tricarboxylate |
| Molecular Weight | 170.99 |
| Pubchem Id | 5289496 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | TRA |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
