Showing entry for 7-Methoxyflavone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038032 |
| Compound Name | 7-Methoxyflavone |
| Structure | ![]() |
| Formula | C16H12O3 |
| InchiKey | QKNDCRMJDZLFEG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)oc(cc2=O)c1ccccc1 |
| Inchi | InChI=1S/C16H12O3/c1-18-12-7-8-13-14(17)10-15(19-16(13)9-12)11-5-3-2-4-6-11/h2-10H,1H3 |
| IUPAC | 7-methoxy-2-phenylchromen-4-one |
| Molecular Weight | 252.08 |
| Pubchem Id | 466268 |
| Chembl Id | CHEMBL16782 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL16782 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
