Showing entry for 1-methoxymethyl-beta-carboline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038065 |
| Compound Name | 1-methoxymethyl-beta-carboline |
| Structure | ![]() |
| Formula | C13H12N2O |
| InchiKey | OELXEULZDKMFCS-UHFFFAOYSA-N |
| SMILES | COCc1nccc2c1[nH]c1c2cccc1 |
| Inchi | InChI=1S/C13H12N2O/c1-16-8-12-13-10(6-7-14-12)9-4-2-3-5-11(9)15-13/h2-7,15H,8H2,1H3 |
| IUPAC | 1-(methoxymethyl)-9H-pyrido[3,4-b]indole |
| Molecular Weight | 212.09 |
| Pubchem Id | 5382686 |
| Chembl Id | CHEMBL3400671 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3400671 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
