Showing entry for (9R,10R)-8,8-Dimethyl-9,10-dihydro-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9,10-diol 10-(2-methylpropionate)
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038415 |
| Compound Name | (9R,10R)-8,8-Dimethyl-9,10-dihydro-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9,10-diol 10-(2-methylpropionate) |
| Structure | ![]() |
| Formula | C18H20O6 |
| InchiKey | JHCPPFWOQPOFRF-HZPDHXFCSA-N |
| SMILES | O=C(C(C)C)O[C@@H]1c2c(ccc3c2oc(=O)cc3)OC([C@@H]1O)(C)C |
| Inchi | InChI=1S/C18H20O6/c1-9(2)17(21)23-15-13-11(24-18(3,4)16(15)20)7-5-10-6-8-12(19)22-14(10)13/h5-9,15-16,20H,1-4H3/t15-,16-/m1/s1 |
| IUPAC | |
| Molecular Weight | 332.13 |
| Pubchem Id | 11034942 |
| Chembl Id | CHEMBL518224 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL518224 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
