Showing entry for benzyl glucopyranoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038427 |
| Compound Name | benzyl glucopyranoside |
| Structure | ![]() |
| Formula | C13H18O6 |
| InchiKey | GKHCBYYBLTXYEV-UHFFFAOYSA-N |
| SMILES | OCC1OC(OCc2ccccc2)C(C(C1O)O)O |
| Inchi | InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2 |
| IUPAC | 2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| Molecular Weight | 270.11 |
| Pubchem Id | 4984739 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50347463 |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
