Showing entry for schisanhenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038694 |
| Compound Name | schisanhenol |
| Structure | ![]() |
| Formula | C23H30O6 |
| InchiKey | FYSHYFPJBONYCQ-UHFFFAOYSA-N |
| SMILES | COc1cc2CC(C)C(C)Cc3c(c2c(c1OC)O)c(OC)c(c(c3)OC)OC |
| Inchi | InChI=1S/C23H30O6/c1-12-8-14-10-16(25-3)21(27-5)20(24)18(14)19-15(9-13(12)2)11-17(26-4)22(28-6)23(19)29-7/h10-13,24H,8-9H2,1-7H3 |
| IUPAC | |
| Molecular Weight | 402.2 |
| Pubchem Id | 433451 |
| Chembl Id | CHEMBL520939 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL520939 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
