Showing entry for Loniphenyruviridoside B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038717 |
| Compound Name | Loniphenyruviridoside B |
| Structure | ![]() |
| Formula | C25H28O12 |
| InchiKey | JANONPLUBJJWRY-LDRWPHMTSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C2[C@H]1C[C@@H](OC2=O)/C(=C(\C(=O)O)/O)/c1ccccc1)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C25H28O12/c1-2-12-13-8-15(17(19(28)22(31)32)11-6-4-3-5-7-11)35-23(33)14(13)10-34-24(12)37-25-21(30)20(29)18(27)16(9-26)36-25/h2-7,10,12-13,15-16,18,20-21,24-30H,1,8-9H2,(H,31,32)/b19-17+/t12-,13+,15-,16-,18-,20+,21-,24+,25+/m1/s1 |
| IUPAC | (E)-3-[(3R,4aS,5R,6S)-5-ethenyl-1-oxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]-2-hydroxy-3-phenylprop-2-enoic acid |
| Molecular Weight | 520.16 |
| Pubchem Id | 56598467 |
| Chembl Id | CHEMBL1928039 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928039 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
