Showing entry for taondiol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038749 |
| Compound Name | taondiol |
| Structure | ![]() |
| Formula | C27H40O3 |
| InchiKey | LRMHPGVONLYGQD-JQGWRLNDSA-N |
| SMILES | Oc1cc2C[C@@H]3[C@](Oc2c(c1)C)(C)CC[C@H]1[C@@]3(C)CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O |
| Inchi | InChI=1S/C27H40O3/c1-16-13-18(28)14-17-15-21-26(5)10-7-19-24(2,3)22(29)9-11-25(19,4)20(26)8-12-27(21,6)30-23(16)17/h13-14,19-22,28-29H,7-12,15H2,1-6H3/t19-,20+,21-,22-,25-,26+,27-/m0/s1 |
| IUPAC | |
| Molecular Weight | 412.3 |
| Pubchem Id | 10409460 |
| Chembl Id | CHEMBL491985 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL491985 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
