Showing entry for hyphenrone A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038859 |
| Compound Name | hyphenrone A |
| Structure | ![]() |
| Formula | C35H52O5 |
| InchiKey | ZLVGNSIYXMAPTF-WOMYUEOPSA-N |
| SMILES | CC(=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@@]2(CC=C(C)C)C(=O)O[C@@](C(=O)[C@H]1C(=O)C(C)C)(C2=O)CC=C(C)C)C |
| Inchi | InChI=1S/C35H52O5/c1-22(2)13-12-18-33(11)27(15-14-23(3)4)21-34(19-16-24(5)6)31(38)35(40-32(34)39,20-17-25(7)8)30(37)28(33)29(36)26(9)10/h13-14,16-17,26-28H,12,15,18-21H2,1-11H3/t27-,28+,33+,34+,35-/m0/s1 |
| IUPAC | |
| Molecular Weight | 552.38 |
| Pubchem Id | 102129926 |
| Chembl Id | CHEMBL3581569 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3581569 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
