Showing entry for CARNOSALDEHYDE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0038967 |
| Compound Name | CARNOSALDEHYDE |
| Structure | ![]() |
| Formula | C20H28O3 |
| InchiKey | RCVGXYUBWJMZTF-MGPUTAFESA-N |
| SMILES | O=C[C@@]12CCCC([C@@H]2CCc2c1c(O)c(c(c2)C(C)C)O)(C)C |
| Inchi | InChI=1S/C20H28O3/c1-12(2)14-10-13-6-7-15-19(3,4)8-5-9-20(15,11-21)16(13)18(23)17(14)22/h10-12,15,22-23H,5-9H2,1-4H3/t15-,20+/m0/s1 |
| IUPAC | (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carbaldehyde |
| Molecular Weight | 316.2 |
| Pubchem Id | 71712255 |
| Chembl Id | CHEMBL2376099 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2376099 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
