Showing entry for 2-Benzyloxyaniline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039144 |
| Compound Name | 2-Benzyloxyaniline |
| Structure | ![]() |
| Formula | C13H13NO |
| InchiKey | PLPVLSBYYOWFKM-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1OCc1ccccc1 |
| Inchi | InChI=1S/C13H13NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9H,10,14H2 |
| IUPAC | 2-phenylmethoxyaniline |
| Molecular Weight | 199.1 |
| Pubchem Id | 240548 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | MJW |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
