Showing entry for Chelidonine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039467 |
| Compound Name | Chelidonine |
| Structure | ![]() |
| Formula | C20H19NO5 |
| InchiKey | GHKISGDRQRSCII-ZOCIIQOWSA-N |
| SMILES | CN1Cc2c([C@@H]3[C@H]1c1cc4OCOc4cc1C[C@@H]3O)ccc1c2OCO1 |
| Inchi | InChI=1S/C20H19NO5/c1-21-7-13-11(2-3-15-20(13)26-9-23-15)18-14(22)4-10-5-16-17(25-8-24-16)6-12(10)19(18)21/h2-3,5-6,14,18-19,22H,4,7-9H2,1H3/t14-,18-,19+/m0/s1 |
| IUPAC | |
| Molecular Weight | 353.13 |
| Pubchem Id | 197810 |
| Chembl Id | CHEMBL496867 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL496867 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
