Showing entry for Candidine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039494 |
| Compound Name | Candidine |
| Structure | ![]() |
| Formula | C23H13N3O2 |
| InchiKey | DXENDDMPDZMHSQ-VXPUYCOJSA-N |
| SMILES | O=C1c2ccccc2N/C/1=c/1\c2nc3ccccc3c(=O)n2c2c1cccc2 |
| Inchi | InChI=1S/C23H13N3O2/c27-21-13-7-1-4-10-16(13)24-20(21)19-15-9-3-6-12-18(15)26-22(19)25-17-11-5-2-8-14(17)23(26)28/h1-12,24H/b20-19- |
| IUPAC | (6Z)-6-(3-oxo-1H-indol-2-ylidene)indolo[2,1-b]quinazolin-12-one |
| Molecular Weight | 363.1 |
| Pubchem Id | 5320815 |
| Chembl Id | CHEMBL503442 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL503442 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
