Showing entry for oxypeucadanin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039572 |
| Compound Name | oxypeucadanin |
| Structure | ![]() |
| Formula | C16H14O5 |
| InchiKey | QTAGQHZOLRFCBU-ZDUSSCGKSA-N |
| SMILES | O=c1ccc2c(o1)cc1c(c2OC[C@@H]2OC2(C)C)cco1 |
| Inchi | InChI=1S/C16H14O5/c1-16(2)13(21-16)8-19-15-9-3-4-14(17)20-12(9)7-11-10(15)5-6-18-11/h3-7,13H,8H2,1-2H3/t13-/m0/s1 |
| IUPAC | 4-[[(2S)-3,3-dimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
| Molecular Weight | 286.08 |
| Pubchem Id | 33306 |
| Chembl Id | CHEMBL510120 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50361376 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL510120 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
