Showing entry for 3,6-Anhydro-D-galactose
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039628 |
| Compound Name | 3,6-Anhydro-D-galactose |
| Structure | ![]() |
| Formula | C6H10O5 |
| InchiKey | DCQFFOLNJVGHLW-RDQKPOQOSA-N |
| SMILES | O[C@H]1O[C@@H]2CO[C@H]([C@H]1O)[C@H]2O |
| Inchi | InChI=1S/C6H10O5/c7-3-2-1-10-5(3)4(8)6(9)11-2/h2-9H,1H2/t2-,3+,4-,5+,6+/m1/s1 |
| IUPAC | (1R,3S,4R,5S,8S)-2,6-dioxabicyclo[3.2.1]octane-3,4,8-triol |
| Molecular Weight | 162.05 |
| Pubchem Id | 13037720 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 9RN |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
