Showing entry for isoscutellarein
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039655 |
| Compound Name | isoscutellarein |
| Structure | ![]() |
| Formula | C15H10O6 |
| InchiKey | NXHQVROAKYDSNW-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)c1cc(=O)c2c(o1)c(O)c(cc2O)O |
| Inchi | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)12-6-10(18)13-9(17)5-11(19)14(20)15(13)21-12/h1-6,16-17,19-20H |
| IUPAC | 5,7,8-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Molecular Weight | 286.05 |
| Pubchem Id | 5281665 |
| Chembl Id | CHEMBL1093284 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1093284 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
