Showing entry for Aristolactam I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039724 |
| Compound Name | Aristolactam I |
| Structure | ![]() |
| Formula | C17H11NO4 |
| InchiKey | MXOKGWUJNGEKBH-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1cc1N=C(c3c1c2c1OCOc1c3)O |
| Inchi | InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19) |
| IUPAC | |
| Molecular Weight | 293.07 |
| Pubchem Id | 96710 |
| Chembl Id | CHEMBL479127 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50306869 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL479127 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
