Showing entry for EPIROSMANOL
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039810 |
| Compound Name | EPIROSMANOL |
| Structure | ![]() |
| Formula | C20H26O5 |
| InchiKey | LCAZOMIGFDQMNC-PYQAKABTSA-N |
| SMILES | O=C1O[C@H]2[C@@H]3[C@]1(CCCC3(C)C)c1c([C@H]2O)cc(c(c1O)O)C(C)C |
| Inchi | InChI=1S/C20H26O5/c1-9(2)10-8-11-12(15(23)13(10)21)20-7-5-6-19(3,4)17(20)16(14(11)22)25-18(20)24/h8-9,14,16-17,21-23H,5-7H2,1-4H3/t14-,16-,17+,20+/m1/s1 |
| IUPAC | |
| Molecular Weight | 346.18 |
| Pubchem Id | 23243694 |
| Chembl Id | CHEMBL2376097 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2376097 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
