Showing entry for anisatin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0039947 |
| Compound Name | anisatin |
| Structure | ![]() |
| Formula | C15H20O8 |
| InchiKey | GEVWHIDSUOMVRI-QWNPAUMXSA-N |
| SMILES | O=C1O[C@@H]2C[C@@]3([C@H]1O)[C@H](C)C[C@H]([C@@]3([C@@]1([C@@]2(C)O)COC1=O)O)O |
| Inchi | InChI=1S/C15H20O8/c1-6-3-7(16)15(21)13(6)4-8(23-10(18)9(13)17)12(2,20)14(15)5-22-11(14)19/h6-9,16-17,20-21H,3-5H2,1-2H3/t6-,7-,8-,9+,12+,13+,14+,15-/m1/s1 |
| IUPAC | |
| Molecular Weight | 328.12 |
| Pubchem Id | 115121 |
| Chembl Id | CHEMBL220362 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL220362 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
