Showing entry for Fisetin Tetramethyl Ether
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040204 |
| Compound Name | Fisetin Tetramethyl Ether |
| Structure | ![]() |
| Formula | C19H18O6 |
| InchiKey | NAMFTZBUZYVNST-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C19H18O6/c1-21-12-6-7-13-15(10-12)25-18(19(24-4)17(13)20)11-5-8-14(22-2)16(9-11)23-3/h5-10H,1-4H3 |
| IUPAC | 2-(3,4-dimethoxyphenyl)-3,7-dimethoxychromen-4-one |
| Molecular Weight | 342.11 |
| Pubchem Id | 631171 |
| Chembl Id | CHEMBL575808 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50439844 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL575808 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
