Showing entry for (R)-Salsolinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040218 |
| Compound Name | (R)-Salsolinol |
| Structure | ![]() |
| Formula | C10H13NO2 |
| InchiKey | IBRKLUSXDYATLG-ZCFIWIBFSA-N |
| SMILES | C[C@H]1NCCc2c1cc(O)c(c2)O |
| Inchi | InChI=1S/C10H13NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h4-6,11-13H,2-3H2,1H3/t6-/m1/s1 |
| IUPAC | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Molecular Weight | 179.09 |
| Pubchem Id | 7157331 |
| Chembl Id | CHEMBL1193327 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50014640 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1193327 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
