Showing entry for 7-Methoxy-2-Methyl-3,4-Dihydro-1H-Isoquinolin-6-Ol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040367 |
| Compound Name | 7-Methoxy-2-Methyl-3,4-Dihydro-1H-Isoquinolin-6-Ol |
| Structure | ![]() |
| Formula | C11H15NO2 |
| InchiKey | VKAPHOQGGQKBAI-UHFFFAOYSA-N |
| SMILES | COc1cc2CN(C)CCc2cc1O |
| Inchi | InChI=1S/C11H15NO2/c1-12-4-3-8-5-10(13)11(14-2)6-9(8)7-12/h5-6,13H,3-4,7H2,1-2H3 |
| IUPAC | 7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol |
| Molecular Weight | 193.11 |
| Pubchem Id | 2752173 |
| Chembl Id | CHEMBL3235514 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50006639 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3235514 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
