Showing entry for 4'-Hydroxywogonin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040411 |
| Compound Name | 4'-Hydroxywogonin |
| Structure | ![]() |
| Formula | C16H12O6 |
| InchiKey | OEZZJTAJYYSQKM-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Inchi | InChI=1S/C16H12O6/c1-21-15-12(20)6-10(18)14-11(19)7-13(22-16(14)15)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| IUPAC | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methoxychromen-4-one |
| Molecular Weight | 300.06 |
| Pubchem Id | 5322078 |
| Chembl Id | CHEMBL245712 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL245712 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
