Showing entry for Thalifasine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040478 |
| Compound Name | Thalifasine |
| Structure | ![]() |
| Formula | C40H46N2O9 |
| InchiKey | JKZGCTOQBIITDP-VMPREFPWSA-N |
| SMILES | COc1c(OC)cc2c(c1Oc1ccc(cc1)C[C@@H]1N(C)CCc3c1cc(OC)c(c3O)OC)C[C@H]1c3c2c(OC)c(c(c3CCN1C)O)OC |
| Inchi | InChI=1S/C40H46N2O9/c1-41-15-13-23-25(19-30(45-3)37(47-5)34(23)43)28(41)17-21-9-11-22(12-10-21)51-36-27-18-29-32-24(14-16-42(29)2)35(44)40(50-8)39(49-7)33(32)26(27)20-31(46-4)38(36)48-6/h9-12,19-20,28-29,43-44H,13-18H2,1-8H3/t28-,29-/m0/s1 |
| IUPAC | |
| Molecular Weight | 698.32 |
| Pubchem Id | 10372546 |
| Chembl Id | CHEMBL510732 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL510732 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
