Showing entry for Ethoxysanguinarine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040505 |
| Compound Name | Ethoxysanguinarine |
| Structure | ![]() |
| Formula | C22H19NO5 |
| InchiKey | FCEXWTOTHXCQCQ-UHFFFAOYSA-N |
| SMILES | CCOC1c2c3OCOc3ccc2c2c(N1C)c1cc3OCOc3cc1cc2 |
| Inchi | InChI=1S/C22H19NO5/c1-3-24-22-19-13(6-7-16-21(19)28-11-25-16)14-5-4-12-8-17-18(27-10-26-17)9-15(12)20(14)23(22)2/h4-9,22H,3,10-11H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 377.13 |
| Pubchem Id | 5317235 |
| Chembl Id | CHEMBL3114674 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3114674 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
