Showing entry for Thalifaberine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040544 |
| Compound Name | Thalifaberine |
| Structure | ![]() |
| Formula | C41H48N2O8 |
| InchiKey | RRKYSGHTIGWTJQ-CONSDPRKSA-N |
| SMILES | COc1c(OC)cc2c(c1Oc1ccc(cc1)C[C@@H]1N(C)CCc3c1cc(OC)c(c3)OC)C[C@H]1c3c2c(OC)c(c(c3CCN1C)OC)OC |
| Inchi | InChI=1S/C41H48N2O8/c1-42-16-14-24-19-32(44-3)33(45-4)21-27(24)30(42)18-23-10-12-25(13-11-23)51-38-29-20-31-35-26(15-17-43(31)2)37(47-6)41(50-9)40(49-8)36(35)28(29)22-34(46-5)39(38)48-7/h10-13,19,21-22,30-31H,14-18,20H2,1-9H3/t30-,31-/m0/s1 |
| IUPAC | |
| Molecular Weight | 696.34 |
| Pubchem Id | 159246 |
| Chembl Id | CHEMBL498913 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL498913 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
