Showing entry for (R)-(+)-Oxypeucedanin Hydrate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040680 |
| Compound Name | (R)-(+)-Oxypeucedanin Hydrate |
| Structure | ![]() |
| Formula | C16H16O6.H2O |
| InchiKey | ZHHBWHODQHTHPS-BTQNPOSSSA-N |
| SMILES | O=c1ccc2c(o1)cc1c(c2OC[C@H](C(O)(C)C)O)cco1.O |
| Inchi | InChI=1S/C16H16O6.H2O/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11;/h3-7,13,17,19H,8H2,1-2H3;1H2/t13-;/m1./s1 |
| IUPAC | 4-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one;hydrate |
| Molecular Weight | 304.09 |
| Pubchem Id | 53319618 |
| Chembl Id | CHEMBL1651088 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1651088 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
