Showing entry for (2E)-3,7-Dimethylocta-2,6-Dienoic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040793 |
| Compound Name | (2E)-3,7-Dimethylocta-2,6-Dienoic Acid |
| Structure | ![]() |
| Formula | C10H16O2 |
| InchiKey | ZHYZQXUYZJNEHD-VQHVLOKHSA-N |
| SMILES | CC(=CCC/C(=C/C(=O)O)/C)C |
| Inchi | InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7+ |
| IUPAC | (2E)-3,7-dimethylocta-2,6-dienoic acid |
| Molecular Weight | 168.12 |
| Pubchem Id | 5275520 |
| Chembl Id | CHEMBL170190 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 58X |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL170190 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
