Showing entry for Loniphenyruviridoside A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0040963 |
| Compound Name | Loniphenyruviridoside A |
| Structure | ![]() |
| Formula | C24H28O10 |
| InchiKey | SCTDPJFVWAWKPB-JBKQMOEBSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@H]2OC=C([C@@H](C2)C3)c2ccccc2)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C24H28O10/c25-8-17-19(26)20(27)21(28)24(33-17)34-23-18-13(15(10-32-23)22(29)30)6-12-7-16(18)31-9-14(12)11-4-2-1-3-5-11/h1-5,9-10,12-13,16-21,23-28H,6-8H2,(H,29,30)/t12-,13-,16-,17-,18+,19-,20+,21-,23+,24+/m1/s1 |
| IUPAC | |
| Molecular Weight | 476.17 |
| Pubchem Id | 57395335 |
| Chembl Id | CHEMBL1928038 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928038 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
