Showing entry for 1-Cinnamoylpiperidine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041010 |
| Compound Name | 1-Cinnamoylpiperidine |
| Structure | ![]() |
| Formula | C14H17NO |
| InchiKey | KNOXUMZPTHELAO-UHFFFAOYSA-N |
| SMILES | O=C(N1CCCCC1)C=Cc1ccccc1 |
| Inchi | InChI=1S/C14H17NO/c16-14(15-11-5-2-6-12-15)10-9-13-7-3-1-4-8-13/h1,3-4,7-10H,2,5-6,11-12H2 |
| IUPAC | 3-phenyl-1-piperidin-1-ylprop-2-en-1-one |
| Molecular Weight | 215.13 |
| Pubchem Id | 223147 |
| Chembl Id | CHEMBL1703375 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1703375 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
