Showing entry for Lycoramine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041067 |
| Compound Name | Lycoramine |
| Structure | ![]() |
| Formula | C17H23NO3 |
| InchiKey | GJRMHIXYLGOZSE-IFIJOSMWSA-N |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@]3(CC[C@H](C1)O)CCN(C2)C |
| Inchi | InChI=1S/C17H23NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-4,12,14,19H,5-10H2,1-2H3/t12-,14+,17+/m1/s1 |
| IUPAC | |
| Molecular Weight | 289.17 |
| Pubchem Id | 11033566 |
| Chembl Id | CHEMBL4167958 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4167958 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
