Showing entry for Moslosooflavone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041192 |
| Compound Name | Moslosooflavone |
| Structure | ![]() |
| Formula | C17H14O5 |
| InchiKey | IHLSBQVBFDTNTC-UHFFFAOYSA-N |
| SMILES | COc1c(OC)cc(c2c1oc(cc2=O)c1ccccc1)O |
| Inchi | InChI=1S/C17H14O5/c1-20-14-9-12(19)15-11(18)8-13(10-6-4-3-5-7-10)22-17(15)16(14)21-2/h3-9,19H,1-2H3 |
| IUPAC | 5-hydroxy-7,8-dimethoxy-2-phenylchromen-4-one |
| Molecular Weight | 298.08 |
| Pubchem Id | 188316 |
| Chembl Id | CHEMBL2235239 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2235239 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
