Showing entry for plumericin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041345 |
| Compound Name | plumericin |
| Structure | ![]() |
| Formula | C15H14O6 |
| InchiKey | VFXXNAVZODKBIW-JKXVGBJFSA-N |
| SMILES | COC(=O)C1=CO[C@H]2[C@H]3[C@@H]1C=C[C@@]13OC(=O)/C(=C/C)/[C@@H]1O2 |
| Inchi | InChI=1S/C15H14O6/c1-3-7-11-15(21-13(7)17)5-4-8-9(12(16)18-2)6-19-14(20-11)10(8)15/h3-6,8,10-11,14H,1-2H3/b7-3+/t8-,10-,11+,14-,15+/m1/s1 |
| IUPAC | |
| Molecular Weight | 290.08 |
| Pubchem Id | 5281545 |
| Chembl Id | CHEMBL517300 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL517300 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
