Showing entry for verbenone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041390 |
| Compound Name | verbenone |
| Structure | ![]() |
| Formula | C10H14O |
| InchiKey | DCSCXTJOXBUFGB-SFYZADRCSA-N |
| SMILES | CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C |
| Inchi | InChI=1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m1/s1 |
| IUPAC | (1R,5R)-2,6,6-trimethylbicyclo[3.1.1]hept-2-en-4-one |
| Molecular Weight | 150.1 |
| Pubchem Id | 65724 |
| Chembl Id | CHEMBL1409937 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1409937 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
