Showing entry for Geranylgeranoic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041422 |
| Compound Name | Geranylgeranoic Acid |
| Structure | ![]() |
| Formula | C20H32O2 |
| InchiKey | SZNLKILVMCHHSD-OZFNKYQOSA-N |
| SMILES | C/C(=C\CC/C(=C/C(=O)O)/C)/CC/C=C(/CCC=C(C)C)\C |
| Inchi | InChI=1S/C20H32O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h9,11,13,15H,6-8,10,12,14H2,1-5H3,(H,21,22)/b17-11+,18-13+,19-15+ |
| IUPAC | (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
| Molecular Weight | 304.24 |
| Pubchem Id | 5275521 |
| Chembl Id | CHEMBL171326 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL171326 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
