Showing entry for Egonol-9(Z),12(Z)Linoleate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041556 |
| Compound Name | Egonol-9(Z),12(Z)Linoleate |
| Structure | ![]() |
| Formula | C37H48O6 |
| InchiKey | NHCDDUNWYVJRPS-NQLNTKRDSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCc1cc(OC)c2c(c1)cc(o2)c1ccc2c(c1)OCO2 |
| Inchi | InChI=1S/C37H48O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-36(38)40-23-18-19-29-24-31-27-33(43-37(31)35(25-29)39-2)30-21-22-32-34(26-30)42-28-41-32/h7-8,10-11,21-22,24-27H,3-6,9,12-20,23,28H2,1-2H3/b8-7-,11-10- |
| IUPAC | 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Molecular Weight | 588.35 |
| Pubchem Id | 56598866 |
| Chembl Id | CHEMBL1834806 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50355395 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1834806 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
