Showing entry for fulvoplumierin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041566 |
| Compound Name | fulvoplumierin |
| Structure | ![]() |
| Formula | C14H12O4 |
| InchiKey | RFUJEBHESHKXKW-PRKJJMSOSA-N |
| SMILES | C/C=C/C=C/1\C=Cc2c1c(=O)occ2C(=O)OC |
| Inchi | InChI=1S/C14H12O4/c1-3-4-5-9-6-7-10-11(13(15)17-2)8-18-14(16)12(9)10/h3-8H,1-2H3/b4-3+,9-5+ |
| IUPAC | methyl (7E)-7-[(E)-but-2-enylidene]-1-oxocyclopenta[c]pyran-4-carboxylate |
| Molecular Weight | 244.07 |
| Pubchem Id | 5281541 |
| Chembl Id | CHEMBL445545 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL445545 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
