Showing entry for 2-Ethyltoluene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041743 |
| Compound Name | 2-Ethyltoluene |
| Structure | ![]() |
| Formula | C9H12 |
| InchiKey | HYFLWBNQFMXCPA-UHFFFAOYSA-N |
| SMILES | CCc1ccccc1C |
| Inchi | InChI=1S/C9H12/c1-3-9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3 |
| IUPAC | 1-ethyl-2-methylbenzene |
| Molecular Weight | 120.09 |
| Pubchem Id | 11903 |
| Chembl Id | CHEMBL364233 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL364233 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
