Showing entry for Gyrocarpine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0041938 |
| Compound Name | Gyrocarpine |
| Structure | ![]() |
| Formula | C37H40N2O6 |
| InchiKey | VXPVPAHQYCJDTP-WDYNHAJCSA-N |
| SMILES | COc1cc2CCN([C@H]3c2cc1Oc1c2c(CCN([C@H]2Cc2ccc(Oc4cc(C3)ccc4OC)cc2)C)cc(c1OC)O)C |
| Inchi | InChI=1S/C37H40N2O6/c1-38-14-12-24-20-32(42-4)34-21-27(24)28(38)17-23-8-11-31(41-3)33(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)19-30(40)36(43-5)37(35)45-34/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29+/m1/s1 |
| IUPAC | |
| Molecular Weight | 608.29 |
| Pubchem Id | 9938773 |
| Chembl Id | CHEMBL463946 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 85442 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463946 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
