Showing entry for 3beta-Acetoxycycloartane-24-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042015 |
| Compound Name | 3beta-Acetoxycycloartane-24-one |
| Structure | ![]() |
| Formula | C32H52O3 |
| InchiKey | YFDBMIHFHLSZBY-HDBHPBSHSA-N |
| SMILES | CC(=O)O[C@H]1CC[C@]23[C@H](C1(C)C)CC[C@@H]1[C@@]3(C2)CC[C@]2([C@@]1(C)CC[C@@H]2[C@@H](CCC(=O)C(C)C)C)C |
| Inchi | InChI=1S/C32H52O3/c1-20(2)24(34)10-9-21(3)23-13-15-30(8)26-12-11-25-28(5,6)27(35-22(4)33)14-16-31(25)19-32(26,31)18-17-29(23,30)7/h20-21,23,25-27H,9-19H2,1-8H3/t21-,23-,25+,26+,27+,29-,30+,31-,32+/m1/s1 |
| IUPAC | |
| Molecular Weight | 484.39 |
| Pubchem Id | 25022553 |
| Chembl Id | CHEMBL3359353 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3359353 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
