Showing entry for ABYSSINOFLAVONE V
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042052 |
| Compound Name | ABYSSINOFLAVONE V |
| Structure | ![]() |
| Formula | C20H18O5 |
| InchiKey | WQCFPYAJTXOZMT-KRWDZBQOSA-N |
| SMILES | Oc1cc2O[C@@H](CC(=O)c2c(c1)O)c1ccc2c(c1)C=CC(O2)(C)C |
| Inchi | InChI=1S/C20H18O5/c1-20(2)6-5-12-7-11(3-4-16(12)25-20)17-10-15(23)19-14(22)8-13(21)9-18(19)24-17/h3-9,17,21-22H,10H2,1-2H3/t17-/m0/s1 |
| IUPAC | (2S)-2-(2,2-dimethylchromen-6-yl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| Molecular Weight | 338.12 |
| Pubchem Id | 16737249 |
| Chembl Id | CHEMBL229170 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50212394 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL229170 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
