Showing entry for Elatol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042088 |
| Compound Name | Elatol |
| Structure | ![]() |
| Formula | C15H22BrClO |
| InchiKey | HZKGRCIKQBHSNA-KCQAQPDRSA-N |
| SMILES | O[C@H]1CC(=C)[C@@]2(C([C@H]1Br)(C)C)CCC(=C(C2)Cl)C |
| Inchi | InChI=1S/C15H22BrClO/c1-9-5-6-15(8-11(9)17)10(2)7-12(18)13(16)14(15,3)4/h12-13,18H,2,5-8H2,1,3-4H3/t12-,13-,15+/m0/s1 |
| IUPAC | (3S,4R,6R)-4-bromo-10-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-9-en-3-ol |
| Molecular Weight | 332.05 |
| Pubchem Id | 479931 |
| Chembl Id | CHEMBL464203 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL464203 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
