Showing entry for Abscisic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042157 |
| Compound Name | Abscisic Acid |
| Structure | ![]() |
| Formula | C15H20O4 |
| InchiKey | JLIDBLDQVAYHNE-QHFMCZIYSA-N |
| SMILES | OC(=O)/C=C(\C=C\[C@]1(O)C(=CC(=O)CC1(C)C)C)/C |
| Inchi | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m0/s1 |
| IUPAC | (2Z,4E)-5-[(1R)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Molecular Weight | 264.14 |
| Pubchem Id | 643732 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | A9S |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
