Showing entry for JERVINE
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042190 |
| Compound Name | JERVINE |
| Structure | ![]() |
| Formula | C27H39NO3 |
| InchiKey | CLEXYFLHGFJONT-WFJAZDIUSA-N |
| SMILES | O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2C(=O)C2=C(C)[C@]4(CC[C@@H]32)O[C@H]2[C@H](C4C)NC[C@H](C2)C)C1)C |
| Inchi | InChI=1S/C27H39NO3/c1-14-11-21-24(28-13-14)16(3)27(31-21)10-8-19-20-6-5-17-12-18(29)7-9-26(17,4)23(20)25(30)22(19)15(27)2/h5,14,16,18-21,23-24,28-29H,6-13H2,1-4H3/t14-,16?,18-,19-,20-,21+,23+,24-,26-,27-/m0/s1 |
| IUPAC | |
| Molecular Weight | 425.29 |
| Pubchem Id | 6093180 |
| Chembl Id | CHEMBL1717145 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1717145 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
