Showing entry for Lonijaposide D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042192 |
| Compound Name | Lonijaposide D |
| Structure | ![]() |
| Formula | C26H31NO13 |
| InchiKey | SQWBLOVFMFTTHY-CUQQVVPFSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1c[n+](CCCC(=O)O)cc(c1)C(=O)O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C26H31NO13/c1-2-15-16(6-5-13-8-14(23(34)35)10-27(9-13)7-3-4-19(29)30)17(24(36)37)12-38-25(15)40-26-22(33)21(32)20(31)18(11-28)39-26/h2,5-6,8-10,12,15-16,18,20-22,25-26,28,31-33H,1,3-4,7,11H2,(H2-,29,30,34,35,36,37)/b6-5+/t15-,16+,18-,20-,21+,22-, |
| IUPAC | |
| Molecular Weight | 565.18 |
| Pubchem Id | 56599664 |
| Chembl Id | CHEMBL1928042 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928042 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
