Showing entry for 3,4-divanillyltetrahydrofuran
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042194 |
| Compound Name | 3,4-divanillyltetrahydrofuran |
| Structure | ![]() |
| Formula | C20H24O5 |
| InchiKey | ROGUIJKVZZROIQ-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1O)CC1COCC1Cc1ccc(c(c1)OC)O |
| Inchi | InChI=1S/C20H24O5/c1-23-19-9-13(3-5-17(19)21)7-15-11-25-12-16(15)8-14-4-6-18(22)20(10-14)24-2/h3-6,9-10,15-16,21-22H,7-8,11-12H2,1-2H3 |
| IUPAC | |
| Molecular Weight | 344.16 |
| Pubchem Id | 182210 |
| Chembl Id | CHEMBL405043 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL405043 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
