Showing entry for Lonijaposide K
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042202 |
| Compound Name | Lonijaposide K |
| Structure | ![]() |
| Formula | C23H27NO11 |
| InchiKey | BSOLHSZWRMTETL-ZHXJFFNMSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1ccc[n+](c1)CC(=O)O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C23H27NO11/c1-2-13-14(6-5-12-4-3-7-24(8-12)9-17(26)27)15(21(31)32)11-33-22(13)35-23-20(30)19(29)18(28)16(10-25)34-23/h2-8,11,13-14,16,18-20,22-23,25,28-30H,1,9-10H2,(H-,26,27,31,32)/b6-5+/t13-,14+,16-,18-,19+,20-,22+,23+/m1/s1 |
| IUPAC | |
| Molecular Weight | 493.16 |
| Pubchem Id | 56599871 |
| Chembl Id | CHEMBL1928049 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928049 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
