Showing entry for 7-O-Galloyltricetiflavan
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042215 |
| Compound Name | 7-O-Galloyltricetiflavan |
| Structure | ![]() |
| Formula | C22H18O10 |
| InchiKey | XQLJWQWRTLHKGO-UHFFFAOYSA-N |
| SMILES | Oc1cc(cc2c1CCC(O2)c1cc(O)c(c(c1)O)O)OC(=O)c1cc(O)c(c(c1)O)O |
| Inchi | InChI=1S/C22H18O10/c23-13-7-11(31-22(30)10-5-16(26)21(29)17(27)6-10)8-19-12(13)1-2-18(32-19)9-3-14(24)20(28)15(25)4-9/h3-8,18,23-29H,1-2H2 |
| IUPAC | |
| Molecular Weight | 442.09 |
| Pubchem Id | 11669392 |
| Chembl Id | CHEMBL498441 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL498441 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
