Showing entry for Isocyclomulberrin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042260 |
| Compound Name | Isocyclomulberrin |
| Structure | ![]() |
| Formula | C25H24O6 |
| InchiKey | PWHGUSAQRRPLSJ-UHFFFAOYSA-N |
| SMILES | CC(=CC1Oc2cc(O)ccc2c2c1c(=O)c1c(o2)cc(c(c1O)CC=C(C)C)O)C |
| Inchi | InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-20-21(23(15)28)24(29)22-19(9-13(3)4)30-18-10-14(26)6-8-16(18)25(22)31-20/h5-6,8-11,19,26-28H,7H2,1-4H3 |
| IUPAC | |
| Molecular Weight | 420.16 |
| Pubchem Id | 5316260 |
| Chembl Id | CHEMBL485976 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL485976 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
